112-17-4 decyl acetate
| product Name |
decyl acetate |
| CAS No |
112-17-4 |
| Synonyms |
N-DECYL ACETATE |
| Molecular Formula |
C12H24O2 |
| Molecular Weight |
200.3178 |
| InChI |
InChI=1/C12H24O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-11H2,1-2H3 |
| EINECS |
203-942-2 |
| Molecular Structure |
|
| Density |
0.87g/cm3 |
| Boiling point |
244.1°C at 760 mmHg |
| Refractive index |
1.429 |
| Flash point |
101.3°C |
| Vapour Pressur |
0.031mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Lucky Liu |
| Telephone |
0086-15665710862 |
| Email |
sales@tzrunlong.com |
| Address |
No. 78, Fushan Road, Biomedical Industrial Park, Dawu Town, Tengzhou, Shandong, 277514 China |
| Contact |
Michael Gan(garoms) |
| Telephone |
+86-573-82262042 |
| Email |
garoms@163.com |
| Address |
No.225, Dongqing Road |