112-17-4 decyl acetate
| Nome del prodotto |
decyl acetate |
| Nome inglese |
decyl acetate; N-DECYL ACETATE |
| Formula molecolare |
C12H24O2 |
| Peso Molecolare |
200.3178 |
| InChI |
InChI=1/C12H24O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-11H2,1-2H3 |
| Numero CAS |
112-17-4 |
| EINECS |
203-942-2 |
| Struttura molecolare |
|
| Densità |
0.87g/cm3 |
| Punto di ebollizione |
244.1°C at 760 mmHg |
| Indice di rifrazione |
1.429 |
| Punto d'infiammabilità |
101.3°C |
| Pressione di vapore |
0.031mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|