2475-45-8 Disperse Blue 1
| ???? |
Disperse Blue 1 |
| ?? ?? |
Disperse Blue 1; |
| ??? |
C14H12N4O2 |
| ??? |
268.2707 |
| InChI |
InChI=1/C14H12N4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H,15-18H2 |
| cas?? |
2475-45-8 |
| EC?? |
219-603-7 |
| ?? ?? |
|
| ?? |
1.595g/cm3 |
| ??? |
711.9°C at 760 mmHg |
| ?? ?? |
1.857 |
| ??? |
384.3°C |
| ??? |
4.09E-20mmHg at 25°C |
| ??? ?? |
T:Toxic;
|
| ??? ?? |
R38:Irritating to skin.;
R41:Risks of serious damage to eyes.;
R43:May cause sensitization by skin contact.;
R45:May cause cancer.;
|
| ?? ?? |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|