2475-45-8 Disperse Blue 1
| Ονομασ?α του προ??ντο? |
Disperse Blue 1 |
| Αγγλικ? ?νομα |
Disperse Blue 1; |
| MF |
C14H12N4O2 |
| Μοριακ? β?ρο? |
268.2707 |
| InChI |
InChI=1/C14H12N4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H,15-18H2 |
| CAS ΟΧΙ |
2475-45-8 |
| EINECS |
219-603-7 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.595g/cm3 |
| Σημε?ο βρασμο? |
711.9°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.857 |
| Σημε?ο αν?φλεξη? |
384.3°C |
| Π?εση ατμ?ν |
4.09E-20mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
T:Toxic;
|
| Κινδ?νου Κ?δικε? |
R38:Irritating to skin.;
R41:Risks of serious damage to eyes.;
R43:May cause sensitization by skin contact.;
R45:May cause cancer.;
|
| Περιγραφ? τη? ασφ?λεια? |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|