2475-45-8 Disperse Blue 1
| Nama produk |
Disperse Blue 1 |
| Nama bahasa Inggris |
Disperse Blue 1; |
| MF |
C14H12N4O2 |
| Berat Molekul |
268.2707 |
| InChI |
InChI=1/C14H12N4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H,15-18H2 |
| CAS NO |
2475-45-8 |
| EINECS |
219-603-7 |
| Struktur Molekul |
|
| Kepadatan |
1.595g/cm3 |
| Titik didih |
711.9°C at 760 mmHg |
| Indeks bias |
1.857 |
| Titik nyala |
384.3°C |
| Tekanan uap |
4.09E-20mmHg at 25°C |
| Simbol bahaya |
T:Toxic;
|
| Kode Risiko |
R38:Irritating to skin.;
R41:Risks of serious damage to eyes.;
R43:May cause sensitization by skin contact.;
R45:May cause cancer.;
|
| Keselamatan Deskripsi |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|