2475-45-8 Disperse Blue 1
| ?????? ?? ??? |
Disperse Blue 1 |
| ???????? ??? |
Disperse Blue 1; |
| ????? ???????? |
C14H12N4O2 |
| ?????? ??? |
268.2707 |
| InChI |
InChI=1/C14H12N4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H,15-18H2 |
| ??? ??????? ?????? |
2475-45-8 |
| EINECS |
219-603-7 |
| ????? ?????? |
|
| ????? |
1.595g/cm3 |
| ????? ?? ??? |
711.9°C at 760 mmHg |
| ??????? ??????? |
1.857 |
| ????? ??????? |
384.3°C |
| ????? ?? ???? |
4.09E-20mmHg at 25°C |
| ???? ?????? |
T:Toxic;
|
| ???? ?? ??? |
R38:Irritating to skin.;
R41:Risks of serious damage to eyes.;
R43:May cause sensitization by skin contact.;
R45:May cause cancer.;
|
| ??????? ????? |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|