ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
| Nome del prodotto |
Methyl 2-methoxypropionate |
| Nome inglese |
Methyl 2-methoxypropionate; 2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
| Formula molecolare |
C5H10O3 |
| Peso Molecolare |
118.1311 |
| InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
| Numero CAS |
17639-76-8 |
| EINECS |
241-622-4 |
| Struttura molecolare |
|
| Densità |
0.973g/cm3 |
| Punto di ebollizione |
136.2°C at 760 mmHg |
| Indice di rifrazione |
1.389 |
| Punto d'infiammabilità |
40.6°C |
| Pressione di vapore |
7.45mmHg at 25°C |
| Codici di Rischio |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|