ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
| ?????? ?? ??? |
Methyl 2-methoxypropionate |
| ???????? ??? |
Methyl 2-methoxypropionate; 2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
| ????? ???????? |
C5H10O3 |
| ?????? ??? |
118.1311 |
| InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
| ??? ??????? ?????? |
17639-76-8 |
| EINECS |
241-622-4 |
| ????? ?????? |
|
| ????? |
0.973g/cm3 |
| ????? ?? ??? |
136.2°C at 760 mmHg |
| ??????? ??????? |
1.389 |
| ????? ??????? |
40.6°C |
| ????? ?? ???? |
7.45mmHg at 25°C |
| ???? ?? ??? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|