ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
| Ονομασ?α του προ??ντο? |
Methyl 2-methoxypropionate |
| Αγγλικ? ?νομα |
Methyl 2-methoxypropionate; 2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
| MF |
C5H10O3 |
| Μοριακ? β?ρο? |
118.1311 |
| InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
| CAS ΟΧΙ |
17639-76-8 |
| EINECS |
241-622-4 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.973g/cm3 |
| Σημε?ο βρασμο? |
136.2°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.389 |
| Σημε?ο αν?φλεξη? |
40.6°C |
| Π?εση ατμ?ν |
7.45mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|