ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
| product Name |
Methyl 2-methoxypropionate |
| CAS No |
17639-76-8 |
| Synonyms |
2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
| Molecular Formula |
C5H10O3 |
| Molecular Weight |
118.1311 |
| InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
| EINECS |
241-622-4 |
| Molecular Structure |
|
| Density |
0.973g/cm3 |
| Boiling point |
136.2°C at 760 mmHg |
| Refractive index |
1.389 |
| Flash point |
40.6°C |
| Vapour Pressur |
7.45mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Mr. Wei |
| Telephone |
+86-573-82813637;82813639 |
| Email |
sales@jlightchem.com |
| Address |
Dongtang slip, Jiaxing Industrial Park, Daqiao Town, Jiaxing, Zhejiang, China. |