618-94-0 3-Nitrobenzhydrazide
| Nama produk |
3-Nitrobenzhydrazide |
| Nama bahasa Inggris |
3-Nitrobenzhydrazide; 3-nitrobenzohydrazide; m-Nitrobenzhydrazide; 3-Nitrobenzoylhydrazine |
| MF |
C7H7N3O3 |
| Berat Molekul |
181.1488 |
| InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
| CAS NO |
618-94-0 |
| EINECS |
210-572-5 |
| Struktur Molekul |
|
| Kepadatan |
1.406g/cm3 |
| Titik lebur |
153-154℃ |
| Indeks bias |
1.621 |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|