618-94-0 3-Nitrobenzhydrazide
| termék neve |
3-Nitrobenzhydrazide |
| Angol név |
3-Nitrobenzhydrazide; 3-nitrobenzohydrazide; m-Nitrobenzhydrazide; 3-Nitrobenzoylhydrazine |
| MF |
C7H7N3O3 |
| Molekulat?meg |
181.1488 |
| InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
| CAS-szám |
618-94-0 |
| EINECS |
210-572-5 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.406g/cm3 |
| Olvadáspont |
153-154℃ |
| T?résmutató |
1.621 |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|