618-94-0 3-Nitrobenzhydrazide
| Nom |
3-Nitrobenzhydrazide |
| Nom anglais |
3-Nitrobenzhydrazide; 3-nitrobenzohydrazide; m-Nitrobenzhydrazide; 3-Nitrobenzoylhydrazine |
| Formule moléculaire |
C7H7N3O3 |
| Poids Moléculaire |
181.1488 |
| InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
| Numéro de registre CAS |
618-94-0 |
| EINECS |
210-572-5 |
| Structure moléculaire |
|
| Densité |
1.406g/cm3 |
| Point de fusion |
153-154℃ |
| Indice de réfraction |
1.621 |
| Codes des risques |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Description de sécurité |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|