618-94-0 3-Nitrobenzhydrazide
| product Name |
3-Nitrobenzhydrazide |
| CAS No |
618-94-0 |
| Synonyms |
3-nitrobenzohydrazide; m-Nitrobenzhydrazide; 3-Nitrobenzoylhydrazine |
| Molecular Formula |
C7H7N3O3 |
| Molecular Weight |
181.1488 |
| InChI |
InChI=1/C7H7N3O3/c8-9-7(11)5-2-1-3-6(4-5)10(12)13/h1-4H,8H2,(H,9,11) |
| EINECS |
210-572-5 |
| Molecular Structure |
|
| Density |
1.406g/cm3 |
| Melting point |
153-154℃ |
| Refractive index |
1.621 |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Specifications |
98% |
| Packing |
25kg/drum |
| Contact |
Miss. Mera Zhou |
| Telephone |
+86-523-87726088 |
| Email |
mera.z@sunmy.com;pj@sunmy.com;524535288@qq.com |
| Address |
Room 203, Building 19, Talent & Technology Plaza, Chengdong High Tech Zone, Taixing City 225400, Jiangsu Province, China |