3085-54-9 4-Methylformanilide
| Ονομασ?α του προ??ντο? |
4-Methylformanilide |
| Αγγλικ? ?νομα |
4-Methylformanilide;4'-Methylformanilide; AI3-01418; Formamide, N-(4-methylphenyl)-; N-(4-methylphenyl)formamide |
| MF |
C8H9NO |
| Μοριακ? β?ρο? |
135.1632 |
| InChI |
InChI=1/C8H9NO/c1-7-2-4-8(5-3-7)9-6-10/h2-6H,1H3,(H,9,10) |
| CAS ΟΧΙ |
3085-54-9 |
| EINECS |
221-400-3 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.103g/cm3 |
| Σημε?ο βρασμο? |
293.5°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.581 |
| Σημε?ο αν?φλεξη? |
166.8°C |
| Π?εση ατμ?ν |
0.00172mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|