3085-54-9 4-Methylformanilide
| Nom |
4-Methylformanilide |
| Nom anglais |
4-Methylformanilide;4'-Methylformanilide; AI3-01418; Formamide, N-(4-methylphenyl)-; N-(4-methylphenyl)formamide |
| Formule moléculaire |
C8H9NO |
| Poids Moléculaire |
135.1632 |
| InChI |
InChI=1/C8H9NO/c1-7-2-4-8(5-3-7)9-6-10/h2-6H,1H3,(H,9,10) |
| Numéro de registre CAS |
3085-54-9 |
| EINECS |
221-400-3 |
| Structure moléculaire |
|
| Densité |
1.103g/cm3 |
| Point d'ébullition |
293.5°C at 760 mmHg |
| Indice de réfraction |
1.581 |
| Point d'éclair |
166.8°C |
| Pression de vapeur |
0.00172mmHg at 25°C |
| Codes des risques |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Description de sécurité |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|