3085-54-9 4-Methylformanilide
| Produkt-Name |
4-Methylformanilide |
| Englischer Name |
4-Methylformanilide;4'-Methylformanilide; AI3-01418; Formamide, N-(4-methylphenyl)-; N-(4-methylphenyl)formamide |
| Molekulare Formel |
C8H9NO |
| Molecular Weight |
135.1632 |
| InChI |
InChI=1/C8H9NO/c1-7-2-4-8(5-3-7)9-6-10/h2-6H,1H3,(H,9,10) |
| CAS Registry Number |
3085-54-9 |
| EINECS |
221-400-3 |
| Molecular Structure |
|
| Dichte |
1.103g/cm3 |
| Siedepunkt |
293.5°C at 760 mmHg |
| Brechungsindex |
1.581 |
| Flammpunkt |
166.8°C |
| Dampfdruck |
0.00172mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|