3085-54-9 4-Methylformanilide
| název vyrobku |
4-Methylformanilide |
| Anglicky název |
4-Methylformanilide;4'-Methylformanilide; AI3-01418; Formamide, N-(4-methylphenyl)-; N-(4-methylphenyl)formamide |
| Molekulární vzorec |
C8H9NO |
| Molekulová hmotnost |
135.1632 |
| InChI |
InChI=1/C8H9NO/c1-7-2-4-8(5-3-7)9-6-10/h2-6H,1H3,(H,9,10) |
| Registra?ní ?íslo CAS |
3085-54-9 |
| EINECS |
221-400-3 |
| Molekulární struktura |
|
| Hustota |
1.103g/cm3 |
| Bod varu |
293.5°C at 760 mmHg |
| Index lomu |
1.581 |
| Bod vzplanutí |
166.8°C |
| Tlak par |
0.00172mmHg at 25°C |
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpe?nostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|