94-46-2 isopentyl benzoate
| ürün Ad? |
isopentyl benzoate |
| ingilizce ad? |
isopentyl benzoate; Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
| Moleküler Formülü |
C12H16O2 |
| Molekül A??rl??? |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| CAS kay?t numaras? |
94-46-2 |
| EINECS |
202-334-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.992g/cm3 |
| Kaynama noktas? |
260°C at 760 mmHg |
| K?r?lma indisi |
1.495 |
| Alevlenme noktas? |
109.4°C |
| Buhar bas?nc? |
0.0125mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|