94-46-2 isopentyl benzoate
| Nom |
isopentyl benzoate |
| Nom anglais |
isopentyl benzoate; Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
| Formule moléculaire |
C12H16O2 |
| Poids Moléculaire |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| Numéro de registre CAS |
94-46-2 |
| EINECS |
202-334-4 |
| Structure moléculaire |
|
| Densité |
0.992g/cm3 |
| Point d'ébullition |
260°C at 760 mmHg |
| Indice de réfraction |
1.495 |
| Point d'éclair |
109.4°C |
| Pression de vapeur |
0.0125mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|