94-46-2 isopentyl benzoate
| Naam product |
isopentyl benzoate |
| Engelse naam |
isopentyl benzoate; Benzoic acid isoamyl ester; 3-methyl-1-butanol benzoate; benzoic acid isopentyl ester; Isoamyl Benzoate; 3-methylbutyl benzoate |
| MF |
C12H16O2 |
| Molecuulgewicht |
192.2542 |
| InChI |
InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
| CAS-nummer |
94-46-2 |
| EINECS |
202-334-4 |
| Moleculaire Structuur |
|
| Dichtheid |
0.992g/cm3 |
| Kookpunt |
260°C at 760 mmHg |
| Brekingsindex |
1.495 |
| Vlampunt |
109.4°C |
| Dampdruk |
0.0125mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|