ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
| ürün Ad? |
2-Methyl-5-nitrobenzonitrile |
| ingilizce ad? |
2-Methyl-5-nitrobenzonitrile; 5-Nitro-o-tolunitrile |
| Moleküler Formülü |
C8H6N2O2 |
| Molekül A??rl??? |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
| CAS kay?t numaras? |
939-83-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.26g/cm3 |
| Ergime noktas? |
103.5-107.5℃ |
| Kaynama noktas? |
291.5°C at 760 mmHg |
| K?r?lma indisi |
1.568 |
| Alevlenme noktas? |
130.1°C |
| Buhar bas?nc? |
0.00194mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|