ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
| název vyrobku |
2-Methyl-5-nitrobenzonitrile |
| Anglicky název |
2-Methyl-5-nitrobenzonitrile; 5-Nitro-o-tolunitrile |
| Molekulární vzorec |
C8H6N2O2 |
| Molekulová hmotnost |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
| Registra?ní ?íslo CAS |
939-83-3 |
| Molekulární struktura |
|
| Hustota |
1.26g/cm3 |
| Bod tání |
103.5-107.5℃ |
| Bod varu |
291.5°C at 760 mmHg |
| Index lomu |
1.568 |
| Bod vzplanutí |
130.1°C |
| Tlak par |
0.00194mmHg at 25°C |
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpe?nostní Popis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|