ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
| Nazwa produktu: |
2-Methyl-5-nitrobenzonitrile |
| Angielska nazwa |
2-Methyl-5-nitrobenzonitrile; 5-Nitro-o-tolunitrile |
| MF |
C8H6N2O2 |
| Masie cz?steczkowej |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
| Nr CAS |
939-83-3 |
| Struktury molekularnej |
|
| G?sto?? |
1.26g/cm3 |
| Temperatura topnienia |
103.5-107.5℃ |
| Temperatura wrzenia |
291.5°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.568 |
| Temperatura zap?onu |
130.1°C |
| Ci?nienie pary |
0.00194mmHg at 25°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|