ChemNet > CAS > 937-64-4 4-chlorophenyl chlorothionoformate
937-64-4 4-chlorophenyl chlorothionoformate
| ürün Ad? |
4-chlorophenyl chlorothionoformate |
| ingilizce ad? |
4-chlorophenyl chlorothionoformate; O-(4-Chlorophenyl chlorothioformate); O-(4-chlorophenyl) carbonochloridothioate; 4-chlorophenyl chlorothioformate |
| Moleküler Formülü |
C7H4Cl2OS |
| Molekül A??rl??? |
207.0771 |
| InChI |
InChI=1/C7H4Cl2OS/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H |
| CAS kay?t numaras? |
937-64-4 |
| EINECS |
213-334-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.46g/cm3 |
| Kaynama noktas? |
251.7°C at 760 mmHg |
| K?r?lma indisi |
1.622 |
| Alevlenme noktas? |
106°C |
| Buhar bas?nc? |
0.0321mmHg at 25°C |
| Risk Kodlar? |
R34:Causes burns.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|