ChemNet > CAS > 937-64-4 4-chlorophenyl chlorothionoformate
937-64-4 4-chlorophenyl chlorothionoformate
| název vyrobku |
4-chlorophenyl chlorothionoformate |
| Anglicky název |
4-chlorophenyl chlorothionoformate; O-(4-Chlorophenyl chlorothioformate); O-(4-chlorophenyl) carbonochloridothioate; 4-chlorophenyl chlorothioformate |
| Molekulární vzorec |
C7H4Cl2OS |
| Molekulová hmotnost |
207.0771 |
| InChI |
InChI=1/C7H4Cl2OS/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H |
| Registra?ní ?íslo CAS |
937-64-4 |
| EINECS |
213-334-9 |
| Molekulární struktura |
|
| Hustota |
1.46g/cm3 |
| Bod varu |
251.7°C at 760 mmHg |
| Index lomu |
1.622 |
| Bod vzplanutí |
106°C |
| Tlak par |
0.0321mmHg at 25°C |
| Riziko Codes |
R34:Causes burns.;
|
| Bezpe?nostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|