ChemNet > CAS > 937-64-4 4-chlorophenyl chlorothionoformate
937-64-4 4-chlorophenyl chlorothionoformate
| Nome del prodotto |
4-chlorophenyl chlorothionoformate |
| Nome inglese |
4-chlorophenyl chlorothionoformate; O-(4-Chlorophenyl chlorothioformate); O-(4-chlorophenyl) carbonochloridothioate; 4-chlorophenyl chlorothioformate |
| Formula molecolare |
C7H4Cl2OS |
| Peso Molecolare |
207.0771 |
| InChI |
InChI=1/C7H4Cl2OS/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H |
| Numero CAS |
937-64-4 |
| EINECS |
213-334-9 |
| Struttura molecolare |
|
| Densità |
1.46g/cm3 |
| Punto di ebollizione |
251.7°C at 760 mmHg |
| Indice di rifrazione |
1.622 |
| Punto d'infiammabilità |
106°C |
| Pressione di vapore |
0.0321mmHg at 25°C |
| Codici di Rischio |
R34:Causes burns.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|