927-67-3 n-Propylthiourea
| ürün Ad? |
n-Propylthiourea |
| ingilizce ad? |
n-Propylthiourea;Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
| Moleküler Formülü |
C4H10N2S |
| Molekül A??rl??? |
118.2006 |
| InChI |
InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
| CAS kay?t numaras? |
927-67-3 |
| EINECS |
213-158-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.054g/cm3 |
| Kaynama noktas? |
182.1°C at 760 mmHg |
| K?r?lma indisi |
1.537 |
| Alevlenme noktas? |
63.9°C |
| Buhar bas?nc? |
0.825mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|