927-67-3 n-Propylthiourea
| Nome do produto |
n-Propylthiourea |
| Nome em inglês |
n-Propylthiourea;Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
| Fórmula molecular |
C4H10N2S |
| Peso Molecular |
118.2006 |
| InChI |
InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
| CAS Registry Number |
927-67-3 |
| EINECS |
213-158-2 |
| Estrutura Molecular |
|
| Densidade |
1.054g/cm3 |
| Ponto de ebuli??o |
182.1°C at 760 mmHg |
| índice de refra??o |
1.537 |
| O ponto de inflama??o |
63.9°C |
| Press?o de vapor |
0.825mmHg at 25°C |
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|