927-67-3 n-Propylthiourea
| Ονομασ?α του προ??ντο? |
n-Propylthiourea |
| Αγγλικ? ?νομα |
n-Propylthiourea;Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
| MF |
C4H10N2S |
| Μοριακ? β?ρο? |
118.2006 |
| InChI |
InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
| CAS ΟΧΙ |
927-67-3 |
| EINECS |
213-158-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.054g/cm3 |
| Σημε?ο βρασμο? |
182.1°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.537 |
| Σημε?ο αν?φλεξη? |
63.9°C |
| Π?εση ατμ?ν |
0.825mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|