723-89-7 1-phenylisatin
| ürün Ad? |
1-phenylisatin |
| ingilizce ad? |
1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI); 1-Phenyl-1H-indole-2,3-dione; 1-Phenyl-indole-2,3-dione; 1-Phenylisatin; 5-21-10-00247 (Beilstein Handbook Reference); BRN 0164531; NSC 100013; Indole-2,3-dione, 1-phenyl- |
| Moleküler Formülü |
C14H9NO2 |
| Molekül A??rl??? |
223.2268 |
| InChI |
InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| CAS kay?t numaras? |
723-89-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.338g/cm3 |
| Ergime noktas? |
138-140℃ |
| Kaynama noktas? |
388.8°C at 760 mmHg |
| K?r?lma indisi |
1.667 |
| Alevlenme noktas? |
182.6°C |
| Buhar bas?nc? |
2.99E-06mmHg at 25°C |
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|