723-89-7 1-phenylisatin
| Nazwa produktu: |
1-phenylisatin |
| Angielska nazwa |
1-phenylisatin;1H-Indole-2,3-dione, 1-phenyl- (9CI); 1-Phenyl-1H-indole-2,3-dione; 1-Phenyl-indole-2,3-dione; 1-Phenylisatin; 5-21-10-00247 (Beilstein Handbook Reference); BRN 0164531; NSC 100013; Indole-2,3-dione, 1-phenyl- |
| MF |
C14H9NO2 |
| Masie cz?steczkowej |
223.2268 |
| InChI |
InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| Nr CAS |
723-89-7 |
| Struktury molekularnej |
|
| G?sto?? |
1.338g/cm3 |
| Temperatura topnienia |
138-140℃ |
| Temperatura wrzenia |
388.8°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.667 |
| Temperatura zap?onu |
182.6°C |
| Ci?nienie pary |
2.99E-06mmHg at 25°C |
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|