723-89-7 1-phenylisatin
| product Name |
1-phenylisatin |
| CAS No |
723-89-7 |
| Synonyms |
1H-Indole-2,3-dione, 1-phenyl- (9CI); 1-Phenyl-1H-indole-2,3-dione; 1-Phenyl-indole-2,3-dione; 1-Phenylisatin; 5-21-10-00247 (Beilstein Handbook Reference); BRN 0164531; NSC 100013; Indole-2,3-dione, 1-phenyl- |
| Molecular Formula |
C14H9NO2 |
| Molecular Weight |
223.2268 |
| InChI |
InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| Molecular Structure |
|
| Density |
1.338g/cm3 |
| Melting point |
138-140℃ |
| Boiling point |
388.8°C at 760 mmHg |
| Refractive index |
1.667 |
| Flash point |
182.6°C |
| Vapour Pressur |
2.99E-06mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |