6267-24-9 Tris(ethylthio)methane
| ürün Ad? |
Tris(ethylthio)methane |
| ingilizce ad? |
Tris(ethylthio)methane; Ethyl orthothioformate~Triethyl trithioorthoformate; {[bis(ethylsulfanyl)methyl]sulfanyl}ethane |
| Moleküler Formülü |
C7H16S3 |
| Molekül A??rl??? |
196.3969 |
| InChI |
InChI=1/C7H16S3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
| CAS kay?t numaras? |
6267-24-9 |
| EINECS |
228-439-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.053g/cm3 |
| Kaynama noktas? |
269.2°C at 760 mmHg |
| K?r?lma indisi |
1.539 |
| Alevlenme noktas? |
111.3°C |
| Buhar bas?nc? |
0.0122mmHg at 25°C |
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|