6267-24-9 Tris(ethylthio)methane
| Nom |
Tris(ethylthio)methane |
| Nom anglais |
Tris(ethylthio)methane; Ethyl orthothioformate~Triethyl trithioorthoformate; {[bis(ethylsulfanyl)methyl]sulfanyl}ethane |
| Formule moléculaire |
C7H16S3 |
| Poids Moléculaire |
196.3969 |
| InChI |
InChI=1/C7H16S3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
| Numéro de registre CAS |
6267-24-9 |
| EINECS |
228-439-5 |
| Structure moléculaire |
|
| Densité |
1.053g/cm3 |
| Point d'ébullition |
269.2°C at 760 mmHg |
| Indice de réfraction |
1.539 |
| Point d'éclair |
111.3°C |
| Pression de vapeur |
0.0122mmHg at 25°C |
| Description de sécurité |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|