6267-24-9 Tris(ethylthio)methane
| product Name |
Tris(ethylthio)methane |
| CAS No |
6267-24-9 |
| Synonyms |
Ethyl orthothioformate~Triethyl trithioorthoformate; {[bis(ethylsulfanyl)methyl]sulfanyl}ethane |
| Molecular Formula |
C7H16S3 |
| Molecular Weight |
196.3969 |
| InChI |
InChI=1/C7H16S3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
| EINECS |
228-439-5 |
| Molecular Structure |
|
| Density |
1.053g/cm3 |
| Boiling point |
269.2°C at 760 mmHg |
| Refractive index |
1.539 |
| Flash point |
111.3°C |
| Vapour Pressur |
0.0122mmHg at 25°C |
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|