624-17-9 Diethyl azelate
| ürün Ad? |
Diethyl azelate |
| ingilizce ad? |
Diethyl azelate; Diethyl azelate, (Azelaic acid diethyl ester; Diethyl; Azelaic acid diethyl ester~Nonanedioic acid diethyl ester; diethyl nonanedioate |
| Moleküler Formülü |
C13H24O4 |
| Molekül A??rl??? |
244.3273 |
| InChI |
InChI=1/C13H24O4/c1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2/h3-11H2,1-2H3 |
| CAS kay?t numaras? |
624-17-9 |
| EINECS |
210-833-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.976g/cm3 |
| Kaynama noktas? |
291.5°C at 760 mmHg |
| K?r?lma indisi |
1.439 |
| Alevlenme noktas? |
129.2°C |
| Buhar bas?nc? |
0.00194mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|