624-17-9 Diethyl azelate
| product Name |
Diethyl azelate |
| CAS No |
624-17-9 |
| Synonyms |
Diethyl azelate, (Azelaic acid diethyl ester; Diethyl; Azelaic acid diethyl ester~Nonanedioic acid diethyl ester; diethyl nonanedioate |
| Molecular Formula |
C13H24O4 |
| Molecular Weight |
244.3273 |
| InChI |
InChI=1/C13H24O4/c1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2/h3-11H2,1-2H3 |
| EINECS |
210-833-3 |
| Molecular Structure |
|
| Density |
0.976g/cm3 |
| Boiling point |
291.5°C at 760 mmHg |
| Refractive index |
1.439 |
| Flash point |
129.2°C |
| Vapour Pressur |
0.00194mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|