624-17-9 Diethyl azelate
| Nome do produto |
Diethyl azelate |
| Nome em inglês |
Diethyl azelate; Diethyl azelate, (Azelaic acid diethyl ester; Diethyl; Azelaic acid diethyl ester~Nonanedioic acid diethyl ester; diethyl nonanedioate |
| Fórmula molecular |
C13H24O4 |
| Peso Molecular |
244.3273 |
| InChI |
InChI=1/C13H24O4/c1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2/h3-11H2,1-2H3 |
| CAS Registry Number |
624-17-9 |
| EINECS |
210-833-3 |
| Estrutura Molecular |
|
| Densidade |
0.976g/cm3 |
| Ponto de ebuli??o |
291.5°C at 760 mmHg |
| índice de refra??o |
1.439 |
| O ponto de inflama??o |
129.2°C |
| Press?o de vapor |
0.00194mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|