622-52-6 P-Tolylthiourea
| ürün Ad? |
P-Tolylthiourea |
| ingilizce ad? |
P-Tolylthiourea; 4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
| Moleküler Formülü |
C8H10N2S |
| Molekül A??rl??? |
166.2434 |
| InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| CAS kay?t numaras? |
622-52-6 |
| EINECS |
210-740-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.242g/cm3 |
| Kaynama noktas? |
282.5°C at 760 mmHg |
| K?r?lma indisi |
1.696 |
| Alevlenme noktas? |
124.6°C |
| Buhar bas?nc? |
0.00335mmHg at 25°C |
| Risk Kodlar? |
R25:Toxic if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|