622-52-6 P-Tolylthiourea
| Nome del prodotto |
P-Tolylthiourea |
| Nome inglese |
P-Tolylthiourea; 4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
| Formula molecolare |
C8H10N2S |
| Peso Molecolare |
166.2434 |
| InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| Numero CAS |
622-52-6 |
| EINECS |
210-740-8 |
| Struttura molecolare |
|
| Densità |
1.242g/cm3 |
| Punto di ebollizione |
282.5°C at 760 mmHg |
| Indice di rifrazione |
1.696 |
| Punto d'infiammabilità |
124.6°C |
| Pressione di vapore |
0.00335mmHg at 25°C |
| Codici di Rischio |
R25:Toxic if swallowed.;
|
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|