622-52-6 P-Tolylthiourea
| Nome do produto |
P-Tolylthiourea |
| Nome em inglês |
P-Tolylthiourea; 4-Methylphenylthiourea; para-Tolylthiourea;
; 1-(4-methylphenyl)thiourea |
| Fórmula molecular |
C8H10N2S |
| Peso Molecular |
166.2434 |
| InChI |
InChI=1/C8H10N2S/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3,(H3,9,10,11) |
| CAS Registry Number |
622-52-6 |
| EINECS |
210-740-8 |
| Estrutura Molecular |
|
| Densidade |
1.242g/cm3 |
| Ponto de ebuli??o |
282.5°C at 760 mmHg |
| índice de refra??o |
1.696 |
| O ponto de inflama??o |
124.6°C |
| Press?o de vapor |
0.00335mmHg at 25°C |
| Códigos de risco |
R25:Toxic if swallowed.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|