613-12-7 2-Methylanthracene
| ürün Ad? |
2-Methylanthracene |
| ingilizce ad? |
2-Methylanthracene;CCRIS 2739; NSC 87376; Anthracene, 2-methyl- |
| Moleküler Formülü |
C15H12 |
| Molekül A??rl??? |
192.2558 |
| InChI |
InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
| CAS kay?t numaras? |
613-12-7 |
| EINECS |
210-329-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.105g/cm3 |
| Ergime noktas? |
202-206℃ |
| Kaynama noktas? |
347.2°C at 760 mmHg |
| K?r?lma indisi |
1.693 |
| Alevlenme noktas? |
157.5°C |
| Buhar bas?nc? |
0.00011mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|