613-12-7 2-Methylanthracene
| termék neve |
2-Methylanthracene |
| Angol név |
2-Methylanthracene;CCRIS 2739; NSC 87376; Anthracene, 2-methyl- |
| MF |
C15H12 |
| Molekulat?meg |
192.2558 |
| InChI |
InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
| CAS-szám |
613-12-7 |
| EINECS |
210-329-3 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.105g/cm3 |
| Olvadáspont |
202-206℃ |
| Forráspont |
347.2°C at 760 mmHg |
| T?résmutató |
1.693 |
| Gyulladáspont |
157.5°C |
| G?znyomás |
0.00011mmHg at 25°C |
| Veszély szimbólumok |
Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|