613-12-7 2-Methylanthracene
| název vyrobku |
2-Methylanthracene |
| Anglicky název |
2-Methylanthracene;CCRIS 2739; NSC 87376; Anthracene, 2-methyl- |
| Molekulární vzorec |
C15H12 |
| Molekulová hmotnost |
192.2558 |
| InChI |
InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
| Registra?ní ?íslo CAS |
613-12-7 |
| EINECS |
210-329-3 |
| Molekulární struktura |
|
| Hustota |
1.105g/cm3 |
| Bod tání |
202-206℃ |
| Bod varu |
347.2°C at 760 mmHg |
| Index lomu |
1.693 |
| Bod vzplanutí |
157.5°C |
| Tlak par |
0.00011mmHg at 25°C |
| Symbol? nebezpe?nosti |
Xn:Harmful;
|
| Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpe?nostní Popis |
S24/25:Avoid contact with skin and eyes.;
|
|