589-82-2 3-Heptanol
| ürün Ad? |
3-Heptanol |
| ingilizce ad? |
3-Heptanol; heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
| Moleküler Formülü |
C7H16O |
| Molekül A??rl??? |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| CAS kay?t numaras? |
589-82-2 |
| EINECS |
209-661-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.818g/cm3 |
| Ergime noktas? |
-70℃ |
| Kaynama noktas? |
156.7°C at 760 mmHg |
| K?r?lma indisi |
1.42 |
| Alevlenme noktas? |
54.4°C |
| Buhar bas?nc? |
1.03mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|