589-82-2 3-Heptanol
| Nome do produto |
3-Heptanol |
| Nome em inglês |
3-Heptanol; heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
| Fórmula molecular |
C7H16O |
| Peso Molecular |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| CAS Registry Number |
589-82-2 |
| EINECS |
209-661-1 |
| Estrutura Molecular |
|
| Densidade |
0.818g/cm3 |
| Ponto de fus?o |
-70℃ |
| Ponto de ebuli??o |
156.7°C at 760 mmHg |
| índice de refra??o |
1.42 |
| O ponto de inflama??o |
54.4°C |
| Press?o de vapor |
1.03mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|