589-82-2 3-Heptanol
| Ονομασ?α του προ??ντο? |
3-Heptanol |
| Αγγλικ? ?νομα |
3-Heptanol; heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
| MF |
C7H16O |
| Μοριακ? β?ρο? |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| CAS ΟΧΙ |
589-82-2 |
| EINECS |
209-661-1 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.818g/cm3 |
| Σημε?ο τ?ξη? |
-70℃ |
| Σημε?ο βρασμο? |
156.7°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.42 |
| Σημε?ο αν?φλεξη? |
54.4°C |
| Π?εση ατμ?ν |
1.03mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|