548-39-0 Perinaphthenone
| ürün Ad? |
Perinaphthenone |
| ingilizce ad? |
Perinaphthenone; phenalen-1-one; Perinaphthalenone; 1H-phenalen-1-one |
| Moleküler Formülü |
C13H8O |
| Molekül A??rl??? |
180.202 |
| InChI |
InChI=1/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H |
| CAS kay?t numaras? |
548-39-0 |
| EINECS |
208-945-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.265g/cm3 |
| Ergime noktas? |
149-154℃ |
| Kaynama noktas? |
355.2°C at 760 mmHg |
| K?r?lma indisi |
1.715 |
| Alevlenme noktas? |
157.9°C |
| Buhar bas?nc? |
3.18E-05mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|