548-39-0 Perinaphthenone
| Nom |
Perinaphthenone |
| Nom anglais |
Perinaphthenone; phenalen-1-one; Perinaphthalenone; 1H-phenalen-1-one |
| Formule moléculaire |
C13H8O |
| Poids Moléculaire |
180.202 |
| InChI |
InChI=1/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H |
| Numéro de registre CAS |
548-39-0 |
| EINECS |
208-945-2 |
| Structure moléculaire |
|
| Densité |
1.265g/cm3 |
| Point de fusion |
149-154℃ |
| Point d'ébullition |
355.2°C at 760 mmHg |
| Indice de réfraction |
1.715 |
| Point d'éclair |
157.9°C |
| Pression de vapeur |
3.18E-05mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|